C13H9F2NO — CID 177204880
7-(difluoromethoxy)-5H-indeno[1,2-b]pyridine (PubChem CID 177204880) has the molecular formula C13H9F2NO and a molecular weight of 233.22 g/mol. Its IUPAC name is 7-(difluoromethoxy)-5H-indeno[1,2-b]pyridine.
| Compound Name | 7-(difluoromethoxy)-5H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 177204880 |
| Molecular Formula | C13H9F2NO |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 7-(difluoromethoxy)-5H-indeno[1,2-b]pyridine |
| SMILES | FC(F)Oc1ccc2c(c1)Cc1cccnc1-2 |
| InChI | InChI=1S/C13H9F2NO/c14-13(15)17-10-3-4-11-9(7-10)6-8-2-1-5-16-12(8)11/h1-5,7,13H,6H2 |
| InChIKey | CYQNCBUWXSJXCU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |