C20H18O4 — CID 11056368
ethyl 2-methoxy-4,5-diphenylfuran-3-carboxylate (PubChem CID 11056368) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is ethyl 2-methoxy-4,5-diphenylfuran-3-carboxylate.
| Compound Name | ethyl 2-methoxy-4,5-diphenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11056368 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethyl 2-methoxy-4,5-diphenylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-3-23-19(21)17-16(14-10-6-4-7-11-14)18(24-20(17)22-2)15-12-8-5-9-13-15/h4-13H,3H2,1-2H3 |
| InChIKey | VTCXIJGSAWXNAZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |