C20H16O4 — CID 164684371
methyl 2-methyl-4-oxo-5,6-diphenylpyran-3-carboxylate (PubChem CID 164684371) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 2-methyl-4-oxo-5,6-diphenylpyran-3-carboxylate.
| Compound Name | methyl 2-methyl-4-oxo-5,6-diphenylpyran-3-carboxylate |
|---|---|
| PubChem CID | 164684371 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 2-methyl-4-oxo-5,6-diphenylpyran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(-c2ccccc2)c(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H16O4/c1-13-16(20(22)23-2)18(21)17(14-9-5-3-6-10-14)19(24-13)15-11-7-4-8-12-15/h3-12H,1-2H3 |
| InChIKey | ICWJUDJNFDVWTB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |