C16H16O4 — CID 11380259
methyl 5-(4-acetylphenyl)-2,4-dimethylfuran-3-carboxylate (PubChem CID 11380259) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 5-(4-acetylphenyl)-2,4-dimethylfuran-3-carboxylate.
| Compound Name | methyl 5-(4-acetylphenyl)-2,4-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11380259 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl 5-(4-acetylphenyl)-2,4-dimethylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(-c2ccc(C(C)=O)cc2)c1C |
| InChI | InChI=1S/C16H16O4/c1-9-14(16(18)19-4)11(3)20-15(9)13-7-5-12(6-8-13)10(2)17/h5-8H,1-4H3 |
| InChIKey | KWJOMVASTNAXRO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |