C15H13NO3 — CID 11149502
methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate (PubChem CID 11149502) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate.
| Compound Name | methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11149502 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C15H13NO3/c1-9-13(15(17)18-3)10(2)19-14(9)12-6-4-11(8-16)5-7-12/h4-7H,1-3H3 |
| InChIKey | BXPXDAHDPVVTGP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |