methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate

C15H13NO3 — CID 11149502

IUPACmethyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate
SMILESCOC(=O)c1c(C)oc(-c2ccc(C#N)cc2)c1C
InChIInChI=1S/C15H13NO3/c1-9-13(15(17)18-3)10(2)19-14(9)12-6-4-11(8-16)5-7-12/h4-7H,1-3H3
InChIKeyBXPXDAHDPVVTGP-UHFFFAOYSA-N
MW255.27 g/mol
LogP3.22
Rot. Bonds2

About methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate

methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate (PubChem CID 11149502) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate
PubChem CID11149502
Molecular FormulaC15H13NO3
Molecular Weight255.27 g/mol
Exact Mass255.09
IUPAC Namemethyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate
SMILESCOC(=O)c1c(C)oc(-c2ccc(C#N)cc2)c1C
InChIInChI=1S/C15H13NO3/c1-9-13(15(17)18-3)10(2)19-14(9)12-6-4-11(8-16)5-7-12/h4-7H,1-3H3
InChIKeyBXPXDAHDPVVTGP-UHFFFAOYSA-N
XLogP3.22
TPSA63.23 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 53.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate?
The IUPAC name of methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate (CID 11149502) is methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate?
The canonical SMILES for methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate is COC(=O)c1c(C)oc(-c2ccc(C#N)cc2)c1C.
What is the InChIKey of methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate?
The InChIKey is BXPXDAHDPVVTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c1-9-13(15(17)18-3)10(2)19-14(9)12-6-4-11(8-16)5-7-12/h4-7H,1-3H3.
What are the key properties of methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate?
methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate has a molecular weight of 255.27 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-cyanophenyl)-2,4-dimethylfuran-3-carboxylate is sourced from PubChem (CID 11149502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).