About methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate
methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate (PubChem CID 102523923) has the molecular formula C28H22O3
and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate |
| PubChem CID | 102523923 |
| Molecular Formula | C28H22O3 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)c2c(-c3ccccc3)oc(C)c2C1c1ccccc1 |
| InChI | InChI=1S/C28H22O3/c1-18-22-23(19-12-6-3-7-13-19)26(28(29)30-2)24(20-14-8-4-9-15-20)25(22)27(31-18)21-16-10-5-11-17-21/h3-17,23H,1-2H3 |
| InChIKey | WUGQITPXJQOOAH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate?
The IUPAC name of methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate (CID 102523923) is methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate.
What is the SMILES notation for methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate?
The canonical SMILES for methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate is COC(=O)C1=C(c2ccccc2)c2c(-c3ccccc3)oc(C)c2C1c1ccccc1.
What is the InChIKey of methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate?
The InChIKey is WUGQITPXJQOOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22O3/c1-18-22-23(19-12-6-3-7-13-19)26(28(29)30-2)24(20-14-8-4-9-15-20)25(22)27(31-18)21-16-10-5-11-17-21/h3-17,23H,1-2H3.
What are the key properties of methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate?
methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate has a molecular weight of 406.48 g/mol, XLogP of 6.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-3,4,6-triphenyl-6H-cyclopenta[c]furan-5-carboxylate is sourced from PubChem (CID 102523923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).