C19H23NO5 — CID 21364275
5-O-(2-methoxyethyl) 3-O-methyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 21364275) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-O-(2-methoxyethyl) 3-O-methyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-methoxyethyl) 3-O-methyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21364275 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-O-(2-methoxyethyl) 3-O-methyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-12-15(18(21)24-4)17(14-8-6-5-7-9-14)16(13(2)20-12)19(22)25-11-10-23-3/h5-9,17,20H,10-11H2,1-4H3 |
| InChIKey | GUQFFLKOJLBCJJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|