C28H27NO7 — CID 23438914
3-O-methyl 5-O-[3-(2-oxochromen-4-yl)oxypropyl] 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23438914) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is 3-O-methyl 5-O-[3-(2-oxochromen-4-yl)oxypropyl] 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[3-(2-oxochromen-4-yl)oxypropyl] 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23438914 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 3-O-methyl 5-O-[3-(2-oxochromen-4-yl)oxypropyl] 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCOc2cc(=O)oc3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C28H27NO7/c1-17-24(27(31)33-3)26(19-10-5-4-6-11-19)25(18(2)29-17)28(32)35-15-9-14-34-22-16-23(30)36-21-13-8-7-12-20(21)22/h4-8,10-13,16,26,29H,9,14-15H2,1-3H3 |
| InChIKey | AXVLUWDCHBVNDY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|