C21H17N3O3 — CID 14639123
ethyl 4-amino-5,6-diphenylfuro[2,3-d]pyrimidine-2-carboxylate (PubChem CID 14639123) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is ethyl 4-amino-5,6-diphenylfuro[2,3-d]pyrimidine-2-carboxylate.
| Compound Name | ethyl 4-amino-5,6-diphenylfuro[2,3-d]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 14639123 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | ethyl 4-amino-5,6-diphenylfuro[2,3-d]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(N)c2c(-c3ccccc3)c(-c3ccccc3)oc2n1 |
| InChI | InChI=1S/C21H17N3O3/c1-2-26-21(25)19-23-18(22)16-15(13-9-5-3-6-10-13)17(27-20(16)24-19)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H2,22,23,24) |
| InChIKey | VKTONOQYRSWQBN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |