About ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate
ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate (PubChem CID 53214240) has the molecular formula C11H11ClN2O3
and a molecular weight of 254.67 g/mol. Its IUPAC name is ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate.
Analyze ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate?
The IUPAC name of ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate (CID 53214240) is ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate.
What is the SMILES notation for ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate?
The canonical SMILES for ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate is CCOC(=O)c1nc(Cl)c2c(C)c(C)oc2n1.
What is the InChIKey of ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate?
The InChIKey is VIIIZEKWCDVRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O3/c1-4-16-11(15)9-13-8(12)7-5(2)6(3)17-10(7)14-9/h4H2,1-3H3.
What are the key properties of ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate?
ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate has a molecular weight of 254.67 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-5,6-dimethylfuro[2,3-d]pyrimidine-2-carboxylate is sourced from PubChem (CID 53214240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).