C10H13NO5 — CID 10513471
diethyl 5-methyl-1,3-oxazole-2,4-dicarboxylate (PubChem CID 10513471) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is diethyl 5-methyl-1,3-oxazole-2,4-dicarboxylate.
| Compound Name | diethyl 5-methyl-1,3-oxazole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10513471 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | diethyl 5-methyl-1,3-oxazole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c(C)o1 |
| InChI | InChI=1S/C10H13NO5/c1-4-14-9(12)7-6(3)16-8(11-7)10(13)15-5-2/h4-5H2,1-3H3 |
| InChIKey | QPFSOEUFUZKBEW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |