C8H10N2O4 — CID 68802765
ethyl 5-carbamoyl-2-methyl-1,3-oxazole-4-carboxylate (PubChem CID 68802765) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is ethyl 5-carbamoyl-2-methyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-carbamoyl-2-methyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 68802765 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | ethyl 5-carbamoyl-2-methyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C)oc1C(N)=O |
| InChI | InChI=1S/C8H10N2O4/c1-3-13-8(12)5-6(7(9)11)14-4(2)10-5/h3H2,1-2H3,(H2,9,11) |
| InChIKey | JNLMONWVIKWILC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |