C8H9NO5 — CID 104865012
dimethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate (PubChem CID 104865012) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is dimethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 104865012 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | dimethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(C)oc1C(=O)OC |
| InChI | InChI=1S/C8H9NO5/c1-4-9-5(7(10)12-2)6(14-4)8(11)13-3/h1-3H3 |
| InChIKey | LQDXEQSVRLRKJR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |