C13H10BrNO5 — CID 102953674
dimethyl 2-(4-bromophenyl)-1,3-oxazole-4,5-dicarboxylate (PubChem CID 102953674) has the molecular formula C13H10BrNO5 and a molecular weight of 340.13 g/mol. Its IUPAC name is dimethyl 2-(4-bromophenyl)-1,3-oxazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(4-bromophenyl)-1,3-oxazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102953674 |
| Molecular Formula | C13H10BrNO5 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | dimethyl 2-(4-bromophenyl)-1,3-oxazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Br)cc2)oc1C(=O)OC |
| InChI | InChI=1S/C13H10BrNO5/c1-18-12(16)9-10(13(17)19-2)20-11(15-9)7-3-5-8(14)6-4-7/h3-6H,1-2H3 |
| InChIKey | YGMZLMHJSVUCIP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |