C14H13NO6 — CID 102953608
dimethyl 2-(3-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylate (PubChem CID 102953608) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is dimethyl 2-(3-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(3-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102953608 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | dimethyl 2-(3-methoxyphenyl)-1,3-oxazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(-c2cccc(OC)c2)oc1C(=O)OC |
| InChI | InChI=1S/C14H13NO6/c1-18-9-6-4-5-8(7-9)12-15-10(13(16)19-2)11(21-12)14(17)20-3/h4-7H,1-3H3 |
| InChIKey | WAPLHJMBPWUQOP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |