C24H19NO4 — CID 44556824
benzyl 2-(3-methoxyphenyl)-5-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 44556824) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is benzyl 2-(3-methoxyphenyl)-5-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl 2-(3-methoxyphenyl)-5-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 44556824 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | benzyl 2-(3-methoxyphenyl)-5-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | COc1cccc(-c2nc(C(=O)OCc3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C24H19NO4/c1-27-20-14-8-13-19(15-20)23-25-21(22(29-23)18-11-6-3-7-12-18)24(26)28-16-17-9-4-2-5-10-17/h2-15H,16H2,1H3 |
| InChIKey | OZRPLDGGLFUTFF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |