C19H17NO3 — CID 139762946
benzyl 2-methyl-5-(4-methylphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 139762946) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl 2-methyl-5-(4-methylphenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl 2-methyl-5-(4-methylphenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 139762946 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | benzyl 2-methyl-5-(4-methylphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | Cc1ccc(-c2oc(C)nc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-13-8-10-16(11-9-13)18-17(20-14(2)23-18)19(21)22-12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | FXFQMVYYBMLTMZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |