C13H13NO5S — CID 142757653
ethyl 2-(benzenesulfonyl)-5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 142757653) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-5-methyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(benzenesulfonyl)-5-methyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 142757653 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(S(=O)(=O)c2ccccc2)oc1C |
| InChI | InChI=1S/C13H13NO5S/c1-3-18-12(15)11-9(2)19-13(14-11)20(16,17)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| InChIKey | NRNWVMUFFSORGF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |