C21H27NO5S — CID 44557449
ethyl 2-[(E)-1-(benzenesulfonyl)-2-methylhept-1-enyl]-5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 44557449) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is ethyl 2-[(E)-1-(benzenesulfonyl)-2-methylhept-1-enyl]-5-methyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(E)-1-(benzenesulfonyl)-2-methylhept-1-enyl]-5-methyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 44557449 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 2-[(E)-1-(benzenesulfonyl)-2-methylhept-1-enyl]-5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | CCCCC/C(C)=C(\c1nc(C(=O)OCC)c(C)o1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO5S/c1-5-7-9-12-15(3)19(28(24,25)17-13-10-8-11-14-17)20-22-18(16(4)27-20)21(23)26-6-2/h8,10-11,13-14H,5-7,9,12H2,1-4H3/b19-15+ |
| InChIKey | QBKXAOWLACCZKD-XDJHFCHBSA-N |
| XLogP | 4.94 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|