C9H11ClN2O2 — CID 59868739
ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate (PubChem CID 59868739) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 59868739 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(Cl)nc1C |
| InChI | InChI=1S/C9H11ClN2O2/c1-4-14-8(13)7-5(2)11-9(10)12-6(7)3/h4H2,1-3H3 |
| InChIKey | QWWCHVHQVYFMJU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |