C25H19N3OS — CID 14639140
5,6-diphenyl-2-(phenylsulfanylmethyl)furo[2,3-d]pyrimidin-4-amine (PubChem CID 14639140) has the molecular formula C25H19N3OS and a molecular weight of 409.51 g/mol. Its IUPAC name is 5,6-diphenyl-2-(phenylsulfanylmethyl)furo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-diphenyl-2-(phenylsulfanylmethyl)furo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 14639140 |
| Molecular Formula | C25H19N3OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5,6-diphenyl-2-(phenylsulfanylmethyl)furo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(CSc2ccccc2)nc2oc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H19N3OS/c26-24-22-21(17-10-4-1-5-11-17)23(18-12-6-2-7-13-18)29-25(22)28-20(27-24)16-30-19-14-8-3-9-15-19/h1-15H,16H2,(H2,26,27,28) |
| InChIKey | CLKLDTIKJMOGHV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |