C20H18N4O — CID 11236121
N'-(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 11236121) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N'-(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11236121 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N'-(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | NCCNc1ncnc2oc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H18N4O/c21-11-12-22-19-17-16(14-7-3-1-4-8-14)18(15-9-5-2-6-10-15)25-20(17)24-13-23-19/h1-10,13H,11-12,21H2,(H,22,23,24) |
| InChIKey | GTIQUXGQYVTWOG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |