C26H27N3O3 — CID 143503812
7-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]heptan-2-one (PubChem CID 143503812) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 7-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]heptan-2-one.
| Compound Name | 7-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]heptan-2-one |
|---|---|
| PubChem CID | 143503812 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 7-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]heptan-2-one |
| SMILES | COc1ccc(-c2c(-c3ccccc3)oc3ncnc(NCCCCCC(C)=O)c23)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-18(30)9-5-4-8-16-27-25-23-22(19-12-14-21(31-2)15-13-19)24(20-10-6-3-7-11-20)32-26(23)29-17-28-25/h3,6-7,10-15,17H,4-5,8-9,16H2,1-2H3,(H,27,28,29) |
| InChIKey | MZTRMDZWZWPZLQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|