C26H27N3O5 — CID 58016838
6-[[6-(2-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 58016838) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 6-[[6-(2-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[6-(2-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58016838 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 6-[[6-(2-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | COc1ccc(-c2c(-c3ccccc3OC)oc3ncnc(NCCCCCC(=O)O)c23)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-32-18-13-11-17(12-14-18)22-23-25(27-15-7-3-4-10-21(30)31)28-16-29-26(23)34-24(22)19-8-5-6-9-20(19)33-2/h5-6,8-9,11-14,16H,3-4,7,10,15H2,1-2H3,(H,30,31)(H,27,28,29) |
| InChIKey | IQNFLFKBEDLNIR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|