C25H24FN3O4 — CID 58016862
6-[[6-(2-fluorophenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 58016862) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is 6-[[6-(2-fluorophenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[6-(2-fluorophenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58016862 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 6-[[6-(2-fluorophenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | COc1ccc(-c2c(-c3ccccc3F)oc3ncnc(NCCCCCC(=O)O)c23)cc1 |
| InChI | InChI=1S/C25H24FN3O4/c1-32-17-12-10-16(11-13-17)21-22-24(27-14-6-2-3-9-20(30)31)28-15-29-25(22)33-23(21)18-7-4-5-8-19(18)26/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | NFDJMMHBZGQHSE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|