C27H29N3O4 — CID 58016843
methyl 6-[[5-(4-methoxy-2-methylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoate (PubChem CID 58016843) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is methyl 6-[[5-(4-methoxy-2-methylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoate.
| Compound Name | methyl 6-[[5-(4-methoxy-2-methylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 58016843 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | methyl 6-[[5-(4-methoxy-2-methylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1ncnc2oc(-c3ccccc3)c(-c3ccc(OC)cc3C)c12 |
| InChI | InChI=1S/C27H29N3O4/c1-18-16-20(32-2)13-14-21(18)23-24-26(28-15-9-5-8-12-22(31)33-3)29-17-30-27(24)34-25(23)19-10-6-4-7-11-19/h4,6-7,10-11,13-14,16-17H,5,8-9,12,15H2,1-3H3,(H,28,29,30) |
| InChIKey | STDQNUFRIUNGJH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|