C24H24N4O3 — CID 25124384
6-[[5-(5-methyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 25124384) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 6-[[5-(5-methyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[5-(5-methyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 25124384 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 6-[[5-(5-methyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)oc3ncnc(NCCCCCC(=O)O)c23)nc1 |
| InChI | InChI=1S/C24H24N4O3/c1-16-11-12-18(26-14-16)20-21-23(25-13-7-3-6-10-19(29)30)27-15-28-24(21)31-22(20)17-8-4-2-5-9-17/h2,4-5,8-9,11-12,14-15H,3,6-7,10,13H2,1H3,(H,29,30)(H,25,27,28) |
| InChIKey | KGYOAZOCZUPOIQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|