C25H23N3O4 — CID 58016813
(E)-6-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hex-2-enoic acid (PubChem CID 58016813) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is (E)-6-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hex-2-enoic acid.
| Compound Name | (E)-6-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hex-2-enoic acid |
|---|---|
| PubChem CID | 58016813 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (E)-6-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]hex-2-enoic acid |
| SMILES | COc1ccc(-c2c(-c3ccccc3)oc3ncnc(NCCC/C=C/C(=O)O)c23)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-31-19-13-11-17(12-14-19)21-22-24(26-15-7-3-6-10-20(29)30)27-16-28-25(22)32-23(21)18-8-4-2-5-9-18/h2,4-6,8-14,16H,3,7,15H2,1H3,(H,29,30)(H,26,27,28)/b10-6+ |
| InChIKey | DGLPKOZUCQKVKK-UXBLZVDNSA-N |
| XLogP | 5.40 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|