C29H35N5O4 — CID 163575551
1-[(3R)-6-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexan-3-yl]-3-ethylurea (PubChem CID 163575551) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is 1-[(3R)-6-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexan-3-yl]-3-ethylurea.
| Compound Name | 1-[(3R)-6-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexan-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 163575551 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 1-[(3R)-6-[[5,6-bis(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexan-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H](CC)CCCNc1ncnc2oc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)c12 |
| InChI | InChI=1S/C29H35N5O4/c1-5-21(34-29(35)30-6-2)8-7-17-31-27-25-24(19-9-13-22(36-3)14-10-19)26(38-28(25)33-18-32-27)20-11-15-23(37-4)16-12-20/h9-16,18,21H,5-8,17H2,1-4H3,(H2,30,34,35)(H,31,32,33)/t21-/m1/s1 |
| InChIKey | GDDPTLROVCFWEC-OAQYLSRUSA-N |
| XLogP | 5.86 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|