C26H26FN3O5 — CID 58016898
6-[[6-(2-fluoro-6-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 58016898) has the molecular formula C26H26FN3O5 and a molecular weight of 479.51 g/mol. Its IUPAC name is 6-[[6-(2-fluoro-6-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[6-(2-fluoro-6-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58016898 |
| Molecular Formula | C26H26FN3O5 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 6-[[6-(2-fluoro-6-methoxyphenyl)-5-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | COc1ccc(-c2c(-c3c(F)cccc3OC)oc3ncnc(NCCCCCC(=O)O)c23)cc1 |
| InChI | InChI=1S/C26H26FN3O5/c1-33-17-12-10-16(11-13-17)21-23-25(28-14-5-3-4-9-20(31)32)29-15-30-26(23)35-24(21)22-18(27)7-6-8-19(22)34-2/h6-8,10-13,15H,3-5,9,14H2,1-2H3,(H,31,32)(H,28,29,30) |
| InChIKey | MDILVWUGYWHKHD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|