C24H17N3O2 — CID 11545358
3-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 11545358) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]phenol.
| Compound Name | 3-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 11545358 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-[(5,6-diphenylfuro[2,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Oc1cccc(Nc2ncnc3oc(-c4ccccc4)c(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C24H17N3O2/c28-19-13-7-12-18(14-19)27-23-21-20(16-8-3-1-4-9-16)22(17-10-5-2-6-11-17)29-24(21)26-15-25-23/h1-15,28H,(H,25,26,27) |
| InChIKey | JYTPSSGTMNEGCI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |