About 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium
5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium (PubChem CID 58280141) has the molecular formula C28H23N3O4Y-2
and a molecular weight of 554.42 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium |
| PubChem CID | 58280141 |
| Molecular Formula | C28H23N3O4Y-2 |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium |
| SMILES | COc1ccc(-c2c(-c3ccccc3)oc3ncnc(Nc4c[c-]ccc4)c23)cc1.[CH2-]C(=O)OC.[Y] |
| InChI | InChI=1S/C25H18N3O2.C3H5O2.Y/c1-29-20-14-12-17(13-15-20)21-22-24(28-19-10-6-3-7-11-19)26-16-27-25(22)30-23(21)18-8-4-2-5-9-18;1-3(4)5-2;/h2-6,8-16H,1H3,(H,26,27,28);1H2,2H3;/q2*-1; |
| InChIKey | SUMNPBIWLICTJO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium?
The IUPAC name of 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium (CID 58280141) is 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium.
What is the SMILES notation for 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium?
The canonical SMILES for 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium is COc1ccc(-c2c(-c3ccccc3)oc3ncnc(Nc4c[c-]ccc4)c23)cc1.[CH2-]C(=O)OC.[Y].
What is the InChIKey of 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium?
The InChIKey is SUMNPBIWLICTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N3O2.C3H5O2.Y/c1-29-20-14-12-17(13-15-20)21-22-24(28-19-10-6-3-7-11-19)26-16-27-25(22)30-23(21)18-8-4-2-5-9-18;1-3(4)5-2;/h2-6,8-16H,1H3,(H,26,27,28);1H2,2H3;/q2*-1;.
What are the key properties of 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium?
5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium has a molecular weight of 554.42 g/mol, XLogP of 6.10, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-N-phenyl-6-phenylfuro[2,3-d]pyrimidin-4-amine;methyl acetate;yttrium is sourced from PubChem (CID 58280141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).