C19H15N3OS — CID 21009748
3-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 21009748) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 3-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol.
| Compound Name | 3-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 21009748 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Cc1sc2ncnc(Nc3cccc(O)c3)c2c1-c1ccccc1 |
| InChI | InChI=1S/C19H15N3OS/c1-12-16(13-6-3-2-4-7-13)17-18(20-11-21-19(17)24-12)22-14-8-5-9-15(23)10-14/h2-11,23H,1H3,(H,20,21,22) |
| InChIKey | GINBNQUQCZWIRN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |