C20H17N3OS — CID 21011484
2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol (PubChem CID 21011484) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol.
| Compound Name | 2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 21011484 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(Nc4ccccc4O)c23)cc1 |
| InChI | InChI=1S/C20H17N3OS/c1-12-7-9-14(10-8-12)17-13(2)25-20-18(17)19(21-11-22-20)23-15-5-3-4-6-16(15)24/h3-11,24H,1-2H3,(H,21,22,23) |
| InChIKey | QCVIFPSTKRHXHS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|