C27H16FN3O2S — CID 28695419
1-[[5-(4-fluorophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione (PubChem CID 28695419) has the molecular formula C27H16FN3O2S and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione.
| Compound Name | 1-[[5-(4-fluorophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 28695419 |
| Molecular Formula | C27H16FN3O2S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione |
| SMILES | Cc1sc2ncnc(Nc3cccc4c3C(=O)c3ccccc3C4=O)c2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H16FN3O2S/c1-14-21(15-9-11-16(28)12-10-15)23-26(29-13-30-27(23)34-14)31-20-8-4-7-19-22(20)25(33)18-6-3-2-5-17(18)24(19)32/h2-13H,1H3,(H,29,30,31) |
| InChIKey | PGPAQQAQINLNFY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|