C24H17N3O2S — CID 3758659
1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)anthracene-9,10-dione (PubChem CID 3758659) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)anthracene-9,10-dione.
| Compound Name | 1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 3758659 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Nc3ncnc4sc5c(c34)CCCC5)cccc21 |
| InChI | InChI=1S/C24H17N3O2S/c28-21-13-6-1-2-7-14(13)22(29)19-16(21)9-5-10-17(19)27-23-20-15-8-3-4-11-18(15)30-24(20)26-12-25-23/h1-2,5-7,9-10,12H,3-4,8,11H2,(H,25,26,27) |
| InChIKey | HASSBHCWCYVITQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|