C28H19N3O2S — CID 28695438
1-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione (PubChem CID 28695438) has the molecular formula C28H19N3O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is 1-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione.
| Compound Name | 1-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 28695438 |
| Molecular Formula | C28H19N3O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]anthracene-9,10-dione |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(Nc4cccc5c4C(=O)c4ccccc4C5=O)c23)cc1 |
| InChI | InChI=1S/C28H19N3O2S/c1-15-10-12-17(13-11-15)22-16(2)34-28-24(22)27(29-14-30-28)31-21-9-5-8-20-23(21)26(33)19-7-4-3-6-18(19)25(20)32/h3-14H,1-2H3,(H,29,30,31) |
| InChIKey | WWWKNPJFBDGEEH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|