C20H14N2O2 — CID 53358877
5,7-diphenyl-1H-quinazoline-2,4-dione (PubChem CID 53358877) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5,7-diphenyl-1H-quinazoline-2,4-dione.
| Compound Name | 5,7-diphenyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 53358877 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5,7-diphenyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2c(-c3ccccc3)cc(-c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C20H14N2O2/c23-19-18-16(14-9-5-2-6-10-14)11-15(13-7-3-1-4-8-13)12-17(18)21-20(24)22-19/h1-12H,(H2,21,22,23,24) |
| InChIKey | NNKZZXZIFHUHIA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |