C12H8N2O2S — CID 10354458
7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 10354458) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10354458 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2scc(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C12H8N2O2S/c15-11-10-9(13-12(16)14-11)8(6-17-10)7-4-2-1-3-5-7/h1-6H,(H2,13,14,15,16) |
| InChIKey | MXMJBTPGEYYXFD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |