C15H14N2O2S — CID 82098425
5-(4-propan-2-ylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 82098425) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 5-(4-propan-2-ylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(4-propan-2-ylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 82098425 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5-(4-propan-2-ylphenyl)-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1ccc(-c2csc3[nH]c(=O)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C15H14N2O2S/c1-8(2)9-3-5-10(6-4-9)11-7-20-14-12(11)13(18)16-15(19)17-14/h3-8H,1-2H3,(H2,16,17,18,19) |
| InChIKey | KNMQKMDORXAJEN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |