C17H14N4O3 — CID 174945142
1,1'-biphenyl;7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 174945142) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1,1'-biphenyl;7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 1,1'-biphenyl;7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 174945142 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1,1'-biphenyl;7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C5H4N4O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1-10H;(H4,6,7,8,9,10,11,12) |
| InChIKey | KBCDOETUXQTMOG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |