C5H6MgN4O3 — CID 173069750
magnesium;7,9-dihydro-3H-purine-2,6,8-trione;hydride (PubChem CID 173069750) has the molecular formula C5H6MgN4O3 and a molecular weight of 194.43 g/mol. Its IUPAC name is magnesium;7,9-dihydro-3H-purine-2,6,8-trione;hydride.
| Compound Name | magnesium;7,9-dihydro-3H-purine-2,6,8-trione;hydride |
|---|---|
| PubChem CID | 173069750 |
| Molecular Formula | C5H6MgN4O3 |
| Molecular Weight | 194.43 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | magnesium;7,9-dihydro-3H-purine-2,6,8-trione;hydride |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C5H4N4O3.Mg.2H/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;;;/h(H4,6,7,8,9,10,11,12);;;/q;+2;2*-1 |
| InChIKey | NQFAPDQGJIKOHS-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.43 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |