C10H10N8O7 — CID 159838887
7,9-dihydro-3H-purine-2,6,8-trione;(2,4,6-trioxo-1,3-diazinan-5-yl)urea (PubChem CID 159838887) has the molecular formula C10H10N8O7 and a molecular weight of 354.24 g/mol. Its IUPAC name is 7,9-dihydro-3H-purine-2,6,8-trione;(2,4,6-trioxo-1,3-diazinan-5-yl)urea.
| Compound Name | 7,9-dihydro-3H-purine-2,6,8-trione;(2,4,6-trioxo-1,3-diazinan-5-yl)urea |
|---|---|
| PubChem CID | 159838887 |
| Molecular Formula | C10H10N8O7 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 7,9-dihydro-3H-purine-2,6,8-trione;(2,4,6-trioxo-1,3-diazinan-5-yl)urea |
| SMILES | NC(=O)NC1C(=O)NC(=O)NC1=O.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C5H6N4O4.C5H4N4O3/c6-4(12)7-1-2(10)8-5(13)9-3(1)11;10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1H,(H3,6,7,12)(H2,8,9,10,11,13);(H4,6,7,8,9,10,11,12) |
| InChIKey | NOKUVFBEABOFOO-UHFFFAOYSA-N |
| XLogP | -4.38 |
| TPSA | 244.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|