C18H14N4O4 — CID 159655980
7,9-dihydro-3H-purine-2,6,8-trione;diphenylmethanone (PubChem CID 159655980) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 7,9-dihydro-3H-purine-2,6,8-trione;diphenylmethanone.
| Compound Name | 7,9-dihydro-3H-purine-2,6,8-trione;diphenylmethanone |
|---|---|
| PubChem CID | 159655980 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 7,9-dihydro-3H-purine-2,6,8-trione;diphenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C13H10O.C5H4N4O3/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1-10H;(H4,6,7,8,9,10,11,12) |
| InChIKey | MSEIFDUNEYPXNQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |