C5H4BN4O3 — CID 174946590
CID 174946590 (PubChem CID 174946590) has the molecular formula C5H4BN4O3 and a molecular weight of 178.92 g/mol.
| Compound Name | CID 174946590 |
|---|---|
| PubChem CID | 174946590 |
| Molecular Formula | C5H4BN4O3 |
| Molecular Weight | 178.92 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1.[B] |
| InChI | InChI=1S/C5H4N4O3.B/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;/h(H4,6,7,8,9,10,11,12); |
| InChIKey | QMJNKYOECBEDLX-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.92 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|