C12H8N2O4 — CID 141371448
6-benzoyl-2,4-dioxo-1H-pyrimidine-5-carbaldehyde (PubChem CID 141371448) has the molecular formula C12H8N2O4 and a molecular weight of 244.21 g/mol. Its IUPAC name is 6-benzoyl-2,4-dioxo-1H-pyrimidine-5-carbaldehyde.
| Compound Name | 6-benzoyl-2,4-dioxo-1H-pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 141371448 |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 6-benzoyl-2,4-dioxo-1H-pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(C(=O)c2ccccc2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H8N2O4/c15-6-8-9(13-12(18)14-11(8)17)10(16)7-4-2-1-3-5-7/h1-6H,(H2,13,14,17,18) |
| InChIKey | TWTZOJAHGXSQTA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|