C12H10N2O3 — CID 123415480
6-hydroxy-5-(2-phenylethenyl)-1H-pyrimidine-2,4-dione (PubChem CID 123415480) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 6-hydroxy-5-(2-phenylethenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(2-phenylethenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123415480 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 6-hydroxy-5-(2-phenylethenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(C=Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N2O3/c15-10-9(11(16)14-12(17)13-10)7-6-8-4-2-1-3-5-8/h1-7H,(H3,13,14,15,16,17) |
| InChIKey | NNVURHZWODBWCE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |