C19H19N3O3 — CID 91115731
5-[(4E,6E)-7-[4-(dimethylamino)phenyl]hepta-1,2,4,6-tetraenyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 91115731) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5-[(4E,6E)-7-[4-(dimethylamino)phenyl]hepta-1,2,4,6-tetraenyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(4E,6E)-7-[4-(dimethylamino)phenyl]hepta-1,2,4,6-tetraenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91115731 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5-[(4E,6E)-7-[4-(dimethylamino)phenyl]hepta-1,2,4,6-tetraenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C=Cc2c(O)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-22(2)15-12-10-14(11-13-15)8-6-4-3-5-7-9-16-17(23)20-19(25)21-18(16)24/h3-6,8-13H,1-2H3,(H3,20,21,23,24,25)/b4-3+,8-6+ |
| InChIKey | YDVWKNJZCSSDKY-PBOULFJWSA-N |
| XLogP | 2.27 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|