C18H20BNO2 — CID 10017260
[4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]phenyl]boronic acid (PubChem CID 10017260) has the molecular formula C18H20BNO2 and a molecular weight of 293.18 g/mol. Its IUPAC name is [4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]phenyl]boronic acid.
| Compound Name | [4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 10017260 |
| Molecular Formula | C18H20BNO2 |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [4-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]phenyl]boronic acid |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C18H20BNO2/c1-20(2)18-13-9-16(10-14-18)6-4-3-5-15-7-11-17(12-8-15)19(21)22/h3-14,21-22H,1-2H3/b5-3+,6-4+ |
| InChIKey | UTSDCMUOJRPRPC-GGWOSOGESA-N |
| XLogP | 2.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|