About acetonitrile;[4-(dimethylamino)phenyl]boronic acid
acetonitrile;[4-(dimethylamino)phenyl]boronic acid (PubChem CID 159831802) has the molecular formula C10H15BN2O2
and a molecular weight of 206.05 g/mol. Its IUPAC name is acetonitrile;[4-(dimethylamino)phenyl]boronic acid.
Molecular Properties
| Compound Name | acetonitrile;[4-(dimethylamino)phenyl]boronic acid |
| PubChem CID | 159831802 |
| Molecular Formula | C10H15BN2O2 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | acetonitrile;[4-(dimethylamino)phenyl]boronic acid |
| SMILES | CC#N.CN(C)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C8H12BNO2.C2H3N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6,11-12H,1-2H3;1H3 |
| InChIKey | NNNZPLOFDGPFJG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;[4-(dimethylamino)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The IUPAC name of acetonitrile;[4-(dimethylamino)phenyl]boronic acid (CID 159831802) is acetonitrile;[4-(dimethylamino)phenyl]boronic acid.
What is the SMILES notation for acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The canonical SMILES for acetonitrile;[4-(dimethylamino)phenyl]boronic acid is CC#N.CN(C)c1ccc(B(O)O)cc1.
What is the InChIKey of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The InChIKey is NNNZPLOFDGPFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BNO2.C2H3N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6,11-12H,1-2H3;1H3.
What are the key properties of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
acetonitrile;[4-(dimethylamino)phenyl]boronic acid has a molecular weight of 206.05 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;[4-(dimethylamino)phenyl]boronic acid is sourced from PubChem (CID 159831802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).