acetonitrile;[4-(dimethylamino)phenyl]boronic acid

C10H15BN2O2 — CID 159831802

IUPACacetonitrile;[4-(dimethylamino)phenyl]boronic acid
SMILESCC#N.CN(C)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H12BNO2.C2H3N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6,11-12H,1-2H3;1H3
InChIKeyNNNZPLOFDGPFJG-UHFFFAOYSA-N
MW206.05 g/mol
LogP-0.04
Rot. Bonds2

About acetonitrile;[4-(dimethylamino)phenyl]boronic acid

acetonitrile;[4-(dimethylamino)phenyl]boronic acid (PubChem CID 159831802) has the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. Its IUPAC name is acetonitrile;[4-(dimethylamino)phenyl]boronic acid.

Molecular Properties

Compound Nameacetonitrile;[4-(dimethylamino)phenyl]boronic acid
PubChem CID159831802
Molecular FormulaC10H15BN2O2
Molecular Weight206.05 g/mol
Exact Mass206.12
IUPAC Nameacetonitrile;[4-(dimethylamino)phenyl]boronic acid
SMILESCC#N.CN(C)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H12BNO2.C2H3N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6,11-12H,1-2H3;1H3
InChIKeyNNNZPLOFDGPFJG-UHFFFAOYSA-N
XLogP-0.04
TPSA67.49 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.05
LogP ≤ 5-0.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze acetonitrile;[4-(dimethylamino)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The IUPAC name of acetonitrile;[4-(dimethylamino)phenyl]boronic acid (CID 159831802) is acetonitrile;[4-(dimethylamino)phenyl]boronic acid.
What is the SMILES notation for acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The canonical SMILES for acetonitrile;[4-(dimethylamino)phenyl]boronic acid is CC#N.CN(C)c1ccc(B(O)O)cc1.
What is the InChIKey of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
The InChIKey is NNNZPLOFDGPFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BNO2.C2H3N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6,11-12H,1-2H3;1H3.
What are the key properties of acetonitrile;[4-(dimethylamino)phenyl]boronic acid?
acetonitrile;[4-(dimethylamino)phenyl]boronic acid has a molecular weight of 206.05 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;[4-(dimethylamino)phenyl]boronic acid is sourced from PubChem (CID 159831802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).